2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid

C8H6Cl2N2O4 — CID 103603441

IUPAC2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid
SMILESO=C(O)CONC(=O)c1cc(Cl)nc(Cl)c1
InChIInChI=1S/C8H6Cl2N2O4/c9-5-1-4(2-6(10)11-5)8(15)12-16-3-7(13)14/h1-2H,3H2,(H,12,15)(H,13,14)
InChIKeyKSWOABKCVWDCAP-UHFFFAOYSA-N
MW265.05 g/mol
LogP1.13
Rot. Bonds4

About 2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid

2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid (PubChem CID 103603441) has the molecular formula C8H6Cl2N2O4 and a molecular weight of 265.05 g/mol. Its IUPAC name is 2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid.

Molecular Properties

Compound Name2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid
PubChem CID103603441
Molecular FormulaC8H6Cl2N2O4
Molecular Weight265.05 g/mol
Exact Mass263.97
IUPAC Name2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid
SMILESO=C(O)CONC(=O)c1cc(Cl)nc(Cl)c1
InChIInChI=1S/C8H6Cl2N2O4/c9-5-1-4(2-6(10)11-5)8(15)12-16-3-7(13)14/h1-2H,3H2,(H,12,15)(H,13,14)
InChIKeyKSWOABKCVWDCAP-UHFFFAOYSA-N
XLogP1.13
TPSA88.52 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.05
LogP ≤ 51.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid?
The IUPAC name of 2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid (CID 103603441) is 2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid.
What is the SMILES notation for 2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid?
The canonical SMILES for 2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid is O=C(O)CONC(=O)c1cc(Cl)nc(Cl)c1.
What is the InChIKey of 2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid?
The InChIKey is KSWOABKCVWDCAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2N2O4/c9-5-1-4(2-6(10)11-5)8(15)12-16-3-7(13)14/h1-2H,3H2,(H,12,15)(H,13,14).
What are the key properties of 2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid?
2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid has a molecular weight of 265.05 g/mol, XLogP of 1.13, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid is sourced from PubChem (CID 103603441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).