C8H6Cl2N2O4 — CID 103603441
2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid (PubChem CID 103603441) has the molecular formula C8H6Cl2N2O4 and a molecular weight of 265.05 g/mol. Its IUPAC name is 2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid.
| Compound Name | 2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid |
|---|---|
| PubChem CID | 103603441 |
| Molecular Formula | C8H6Cl2N2O4 |
| Molecular Weight | 265.05 g/mol |
| Exact Mass | 263.97 |
| IUPAC Name | 2-[(2,6-dichloropyridine-4-carbonyl)amino]oxyacetic acid |
| SMILES | O=C(O)CONC(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C8H6Cl2N2O4/c9-5-1-4(2-6(10)11-5)8(15)12-16-3-7(13)14/h1-2H,3H2,(H,12,15)(H,13,14) |
| InChIKey | KSWOABKCVWDCAP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.05 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|