C9H7BrFNO4 — CID 63929905
2-[(3-bromo-5-fluorobenzoyl)amino]oxyacetic acid (PubChem CID 63929905) has the molecular formula C9H7BrFNO4 and a molecular weight of 292.06 g/mol. Its IUPAC name is 2-[(3-bromo-5-fluorobenzoyl)amino]oxyacetic acid.
| Compound Name | 2-[(3-bromo-5-fluorobenzoyl)amino]oxyacetic acid |
|---|---|
| PubChem CID | 63929905 |
| Molecular Formula | C9H7BrFNO4 |
| Molecular Weight | 292.06 g/mol |
| Exact Mass | 290.95 |
| IUPAC Name | 2-[(3-bromo-5-fluorobenzoyl)amino]oxyacetic acid |
| SMILES | O=C(O)CONC(=O)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C9H7BrFNO4/c10-6-1-5(2-7(11)3-6)9(15)12-16-4-8(13)14/h1-3H,4H2,(H,12,15)(H,13,14) |
| InChIKey | LKJPYHPYXBPPNQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.06 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|