C8H7FN2O4 — CID 104785595
2-[(5-fluoropyridine-3-carbonyl)amino]oxyacetic acid (PubChem CID 104785595) has the molecular formula C8H7FN2O4 and a molecular weight of 214.15 g/mol. Its IUPAC name is 2-[(5-fluoropyridine-3-carbonyl)amino]oxyacetic acid.
| Compound Name | 2-[(5-fluoropyridine-3-carbonyl)amino]oxyacetic acid |
|---|---|
| PubChem CID | 104785595 |
| Molecular Formula | C8H7FN2O4 |
| Molecular Weight | 214.15 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-[(5-fluoropyridine-3-carbonyl)amino]oxyacetic acid |
| SMILES | O=C(O)CONC(=O)c1cncc(F)c1 |
| InChI | InChI=1S/C8H7FN2O4/c9-6-1-5(2-10-3-6)8(14)11-15-4-7(12)13/h1-3H,4H2,(H,11,14)(H,12,13) |
| InChIKey | NCEODUOESMEMBI-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.15 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|