C14H10FNO2 — CID 114080622
1-(5-fluoro-3-pyridinyl)-3-phenylpropane-1,3-dione (PubChem CID 114080622) has the molecular formula C14H10FNO2 and a molecular weight of 243.24 g/mol. Its IUPAC name is 1-(5-fluoro-3-pyridinyl)-3-phenylpropane-1,3-dione.
| Compound Name | 1-(5-fluoro-3-pyridinyl)-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 114080622 |
| Molecular Formula | C14H10FNO2 |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1-(5-fluoro-3-pyridinyl)-3-phenylpropane-1,3-dione |
| SMILES | O=C(CC(=O)c1cncc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C14H10FNO2/c15-12-6-11(8-16-9-12)14(18)7-13(17)10-4-2-1-3-5-10/h1-6,8-9H,7H2 |
| InChIKey | JHFBTRJFRYXTCV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|