C11H11BrFNO3S — CID 119242061
2-[2-[(3-bromo-5-fluorobenzoyl)amino]ethylsulfanyl]acetic acid (PubChem CID 119242061) has the molecular formula C11H11BrFNO3S and a molecular weight of 336.18 g/mol. Its IUPAC name is 2-[2-[(3-bromo-5-fluorobenzoyl)amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[(3-bromo-5-fluorobenzoyl)amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119242061 |
| Molecular Formula | C11H11BrFNO3S |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | 2-[2-[(3-bromo-5-fluorobenzoyl)amino]ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCNC(=O)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C11H11BrFNO3S/c12-8-3-7(4-9(13)5-8)11(17)14-1-2-18-6-10(15)16/h3-5H,1-2,6H2,(H,14,17)(H,15,16) |
| InChIKey | DRIANPWLPGFXNJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|