C9H10BrNO4S — CID 115731506
2-[2-[(5-bromofuran-3-carbonyl)amino]ethylsulfanyl]acetic acid (PubChem CID 115731506) has the molecular formula C9H10BrNO4S and a molecular weight of 308.15 g/mol. Its IUPAC name is 2-[2-[(5-bromofuran-3-carbonyl)amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[(5-bromofuran-3-carbonyl)amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 115731506 |
| Molecular Formula | C9H10BrNO4S |
| Molecular Weight | 308.15 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | 2-[2-[(5-bromofuran-3-carbonyl)amino]ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCNC(=O)c1coc(Br)c1 |
| InChI | InChI=1S/C9H10BrNO4S/c10-7-3-6(4-15-7)9(14)11-1-2-16-5-8(12)13/h3-4H,1-2,5H2,(H,11,14)(H,12,13) |
| InChIKey | JKFNAGFVRKOASI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.15 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|