C17H24N2O4S — CID 119241844
2-[2-[[4-(2,2-dimethylpropylcarbamoyl)benzoyl]amino]ethylsulfanyl]acetic acid (PubChem CID 119241844) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-[2-[[4-(2,2-dimethylpropylcarbamoyl)benzoyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[4-(2,2-dimethylpropylcarbamoyl)benzoyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241844 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[2-[[4-(2,2-dimethylpropylcarbamoyl)benzoyl]amino]ethylsulfanyl]acetic acid |
| SMILES | CC(C)(C)CNC(=O)c1ccc(C(=O)NCCSCC(=O)O)cc1 |
| InChI | InChI=1S/C17H24N2O4S/c1-17(2,3)11-19-16(23)13-6-4-12(5-7-13)15(22)18-8-9-24-10-14(20)21/h4-7H,8-11H2,1-3H3,(H,18,22)(H,19,23)(H,20,21) |
| InChIKey | QWMRCIISJRUYCV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|