C15H22N2O5S2 — CID 119241930
2-[2-[[4-(2-methylpropylsulfamoyl)benzoyl]amino]ethylsulfanyl]acetic acid (PubChem CID 119241930) has the molecular formula C15H22N2O5S2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 2-[2-[[4-(2-methylpropylsulfamoyl)benzoyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[4-(2-methylpropylsulfamoyl)benzoyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241930 |
| Molecular Formula | C15H22N2O5S2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-[2-[[4-(2-methylpropylsulfamoyl)benzoyl]amino]ethylsulfanyl]acetic acid |
| SMILES | CC(C)CNS(=O)(=O)c1ccc(C(=O)NCCSCC(=O)O)cc1 |
| InChI | InChI=1S/C15H22N2O5S2/c1-11(2)9-17-24(21,22)13-5-3-12(4-6-13)15(20)16-7-8-23-10-14(18)19/h3-6,11,17H,7-10H2,1-2H3,(H,16,20)(H,18,19) |
| InChIKey | XXSHAZNIXJGEQB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|