C12H12BrNO5S — CID 120687639
2-[2-[(7-bromo-1,3-benzodioxole-5-carbonyl)amino]ethylsulfanyl]acetic acid (PubChem CID 120687639) has the molecular formula C12H12BrNO5S and a molecular weight of 362.20 g/mol. Its IUPAC name is 2-[2-[(7-bromo-1,3-benzodioxole-5-carbonyl)amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[(7-bromo-1,3-benzodioxole-5-carbonyl)amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 120687639 |
| Molecular Formula | C12H12BrNO5S |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 2-[2-[(7-bromo-1,3-benzodioxole-5-carbonyl)amino]ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCNC(=O)c1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C12H12BrNO5S/c13-8-3-7(4-9-11(8)19-6-18-9)12(17)14-1-2-20-5-10(15)16/h3-4H,1-2,5-6H2,(H,14,17)(H,15,16) |
| InChIKey | REOQJVAKORAFIU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|