C13H15BrN2O3 — CID 119389791
7-bromo-N-piperidin-4-yl-1,3-benzodioxole-5-carboxamide (PubChem CID 119389791) has the molecular formula C13H15BrN2O3 and a molecular weight of 327.18 g/mol. Its IUPAC name is 7-bromo-N-piperidin-4-yl-1,3-benzodioxole-5-carboxamide.
| Compound Name | 7-bromo-N-piperidin-4-yl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 119389791 |
| Molecular Formula | C13H15BrN2O3 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 7-bromo-N-piperidin-4-yl-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NC1CCNCC1)c1cc(Br)c2c(c1)OCO2 |
| InChI | InChI=1S/C13H15BrN2O3/c14-10-5-8(6-11-12(10)19-7-18-11)13(17)16-9-1-3-15-4-2-9/h5-6,9,15H,1-4,7H2,(H,16,17) |
| InChIKey | HDOYQIJXDBFMQM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |