C14H17BrN2O3 — CID 120602219
7-bromo-N-(2-methylpiperidin-4-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 120602219) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.21 g/mol. Its IUPAC name is 7-bromo-N-(2-methylpiperidin-4-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 7-bromo-N-(2-methylpiperidin-4-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 120602219 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 7-bromo-N-(2-methylpiperidin-4-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | CC1CC(NC(=O)c2cc(Br)c3c(c2)OCO3)CCN1 |
| InChI | InChI=1S/C14H17BrN2O3/c1-8-4-10(2-3-16-8)17-14(18)9-5-11(15)13-12(6-9)19-7-20-13/h5-6,8,10,16H,2-4,7H2,1H3,(H,17,18) |
| InChIKey | XRWZSTIFMZXFOF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |