C10H15N3O3S — CID 119242434
2-[2-[(2,5-dimethylpyrazole-3-carbonyl)amino]ethylsulfanyl]acetic acid (PubChem CID 119242434) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-[2-[(2,5-dimethylpyrazole-3-carbonyl)amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[(2,5-dimethylpyrazole-3-carbonyl)amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119242434 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-[2-[(2,5-dimethylpyrazole-3-carbonyl)amino]ethylsulfanyl]acetic acid |
| SMILES | Cc1cc(C(=O)NCCSCC(=O)O)n(C)n1 |
| InChI | InChI=1S/C10H15N3O3S/c1-7-5-8(13(2)12-7)10(16)11-3-4-17-6-9(14)15/h5H,3-4,6H2,1-2H3,(H,11,16)(H,14,15) |
| InChIKey | OCZXSJNMQLBZIP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|