2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid

C8H11N3O4 — CID 66129033

IUPAC2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid
SMILESCc1cc(C(=O)NOCC(=O)O)n(C)n1
InChIInChI=1S/C8H11N3O4/c1-5-3-6(11(2)9-5)8(14)10-15-4-7(12)13/h3H,4H2,1-2H3,(H,10,14)(H,12,13)
InChIKeyUHNHEGKMLPGFAA-UHFFFAOYSA-N
MW213.19 g/mol
LogP-0.53
Rot. Bonds4

About 2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid

2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid (PubChem CID 66129033) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is 2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid.

Molecular Properties

Compound Name2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid
PubChem CID66129033
Molecular FormulaC8H11N3O4
Molecular Weight213.19 g/mol
Exact Mass213.07
IUPAC Name2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid
SMILESCc1cc(C(=O)NOCC(=O)O)n(C)n1
InChIInChI=1S/C8H11N3O4/c1-5-3-6(11(2)9-5)8(14)10-15-4-7(12)13/h3H,4H2,1-2H3,(H,10,14)(H,12,13)
InChIKeyUHNHEGKMLPGFAA-UHFFFAOYSA-N
XLogP-0.53
TPSA93.45 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.19
LogP ≤ 5-0.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid?
The IUPAC name of 2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid (CID 66129033) is 2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid.
What is the SMILES notation for 2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid?
The canonical SMILES for 2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid is Cc1cc(C(=O)NOCC(=O)O)n(C)n1.
What is the InChIKey of 2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid?
The InChIKey is UHNHEGKMLPGFAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O4/c1-5-3-6(11(2)9-5)8(14)10-15-4-7(12)13/h3H,4H2,1-2H3,(H,10,14)(H,12,13).
What are the key properties of 2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid?
2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid has a molecular weight of 213.19 g/mol, XLogP of -0.53, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid is sourced from PubChem (CID 66129033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).