C8H11N3O4 — CID 66129033
2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid (PubChem CID 66129033) has the molecular formula C8H11N3O4 and a molecular weight of 213.19 g/mol. Its IUPAC name is 2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid.
| Compound Name | 2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid |
|---|---|
| PubChem CID | 66129033 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 2-[(2,5-dimethylpyrazole-3-carbonyl)amino]oxyacetic acid |
| SMILES | Cc1cc(C(=O)NOCC(=O)O)n(C)n1 |
| InChI | InChI=1S/C8H11N3O4/c1-5-3-6(11(2)9-5)8(14)10-15-4-7(12)13/h3H,4H2,1-2H3,(H,10,14)(H,12,13) |
| InChIKey | UHNHEGKMLPGFAA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|