C10H13BrN2O4 — CID 63929907
2-[(4-bromo-1-propan-2-ylpyrrole-2-carbonyl)amino]oxyacetic acid (PubChem CID 63929907) has the molecular formula C10H13BrN2O4 and a molecular weight of 305.13 g/mol. Its IUPAC name is 2-[(4-bromo-1-propan-2-ylpyrrole-2-carbonyl)amino]oxyacetic acid.
| Compound Name | 2-[(4-bromo-1-propan-2-ylpyrrole-2-carbonyl)amino]oxyacetic acid |
|---|---|
| PubChem CID | 63929907 |
| Molecular Formula | C10H13BrN2O4 |
| Molecular Weight | 305.13 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 2-[(4-bromo-1-propan-2-ylpyrrole-2-carbonyl)amino]oxyacetic acid |
| SMILES | CC(C)n1cc(Br)cc1C(=O)NOCC(=O)O |
| InChI | InChI=1S/C10H13BrN2O4/c1-6(2)13-4-7(11)3-8(13)10(16)12-17-5-9(14)15/h3-4,6H,5H2,1-2H3,(H,12,16)(H,14,15) |
| InChIKey | PLOHPLLPAYFALT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.13 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|