C11H16BrN3O3 — CID 83203517
2-[(4-bromo-1-propan-2-ylpyrrole-2-carbonyl)amino]ethyl carbamate (PubChem CID 83203517) has the molecular formula C11H16BrN3O3 and a molecular weight of 318.17 g/mol. Its IUPAC name is 2-[(4-bromo-1-propan-2-ylpyrrole-2-carbonyl)amino]ethyl carbamate.
| Compound Name | 2-[(4-bromo-1-propan-2-ylpyrrole-2-carbonyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83203517 |
| Molecular Formula | C11H16BrN3O3 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 2-[(4-bromo-1-propan-2-ylpyrrole-2-carbonyl)amino]ethyl carbamate |
| SMILES | CC(C)n1cc(Br)cc1C(=O)NCCOC(N)=O |
| InChI | InChI=1S/C11H16BrN3O3/c1-7(2)15-6-8(12)5-9(15)10(16)14-3-4-18-11(13)17/h5-7H,3-4H2,1-2H3,(H2,13,17)(H,14,16) |
| InChIKey | YTJRLRNFMIXIBE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|