C14H23BrN2O — CID 54913924
4-bromo-N-(4-methylpentyl)-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 54913924) has the molecular formula C14H23BrN2O and a molecular weight of 315.26 g/mol. Its IUPAC name is 4-bromo-N-(4-methylpentyl)-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-(4-methylpentyl)-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 54913924 |
| Molecular Formula | C14H23BrN2O |
| Molecular Weight | 315.26 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-bromo-N-(4-methylpentyl)-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(C)CCCNC(=O)c1cc(Br)cn1C(C)C |
| InChI | InChI=1S/C14H23BrN2O/c1-10(2)6-5-7-16-14(18)13-8-12(15)9-17(13)11(3)4/h8-11H,5-7H2,1-4H3,(H,16,18) |
| InChIKey | DNFXWIVJEKWGRF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|