C14H23BrN2O2 — CID 82943572
4-bromo-1-propan-2-yl-N-(3-propoxypropyl)pyrrole-2-carboxamide (PubChem CID 82943572) has the molecular formula C14H23BrN2O2 and a molecular weight of 331.25 g/mol. Its IUPAC name is 4-bromo-1-propan-2-yl-N-(3-propoxypropyl)pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-propan-2-yl-N-(3-propoxypropyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 82943572 |
| Molecular Formula | C14H23BrN2O2 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 4-bromo-1-propan-2-yl-N-(3-propoxypropyl)pyrrole-2-carboxamide |
| SMILES | CCCOCCCNC(=O)c1cc(Br)cn1C(C)C |
| InChI | InChI=1S/C14H23BrN2O2/c1-4-7-19-8-5-6-16-14(18)13-9-12(15)10-17(13)11(2)3/h9-11H,4-8H2,1-3H3,(H,16,18) |
| InChIKey | MVGOFWUCQCPODN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|