C11H14BrF3N2OS — CID 103706867
4-bromo-1-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrrole-2-carboxamide (PubChem CID 103706867) has the molecular formula C11H14BrF3N2OS and a molecular weight of 359.21 g/mol. Its IUPAC name is 4-bromo-1-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrrole-2-carboxamide.
| Compound Name | 4-bromo-1-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 103706867 |
| Molecular Formula | C11H14BrF3N2OS |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 4-bromo-1-propan-2-yl-N-[2-(trifluoromethylsulfanyl)ethyl]pyrrole-2-carboxamide |
| SMILES | CC(C)n1cc(Br)cc1C(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C11H14BrF3N2OS/c1-7(2)17-6-8(12)5-9(17)10(18)16-3-4-19-11(13,14)15/h5-7H,3-4H2,1-2H3,(H,16,18) |
| InChIKey | NMXMTVXINSDYIZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|