C16H18BrFN2O — CID 43641734
4-bromo-N-[2-(3-fluorophenyl)ethyl]-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 43641734) has the molecular formula C16H18BrFN2O and a molecular weight of 353.24 g/mol. Its IUPAC name is 4-bromo-N-[2-(3-fluorophenyl)ethyl]-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[2-(3-fluorophenyl)ethyl]-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43641734 |
| Molecular Formula | C16H18BrFN2O |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 4-bromo-N-[2-(3-fluorophenyl)ethyl]-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | CC(C)n1cc(Br)cc1C(=O)NCCc1cccc(F)c1 |
| InChI | InChI=1S/C16H18BrFN2O/c1-11(2)20-10-13(17)9-15(20)16(21)19-7-6-12-4-3-5-14(18)8-12/h3-5,8-11H,6-7H2,1-2H3,(H,19,21) |
| InChIKey | BLYVVGUZPAKGRG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |