C13H19BrN2O3 — CID 64670742
3-[(4-bromo-1-propan-2-ylpyrrole-2-carbonyl)amino]-3-methylbutanoic acid (PubChem CID 64670742) has the molecular formula C13H19BrN2O3 and a molecular weight of 331.21 g/mol. Its IUPAC name is 3-[(4-bromo-1-propan-2-ylpyrrole-2-carbonyl)amino]-3-methylbutanoic acid.
| Compound Name | 3-[(4-bromo-1-propan-2-ylpyrrole-2-carbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 64670742 |
| Molecular Formula | C13H19BrN2O3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 3-[(4-bromo-1-propan-2-ylpyrrole-2-carbonyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)n1cc(Br)cc1C(=O)NC(C)(C)CC(=O)O |
| InChI | InChI=1S/C13H19BrN2O3/c1-8(2)16-7-9(14)5-10(16)12(19)15-13(3,4)6-11(17)18/h5,7-8H,6H2,1-4H3,(H,15,19)(H,17,18) |
| InChIKey | SRSZLENBNKZDRI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |