C9H13N3O4 — CID 66121113
2-[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]oxyacetic acid (PubChem CID 66121113) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]oxyacetic acid.
| Compound Name | 2-[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]oxyacetic acid |
|---|---|
| PubChem CID | 66121113 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-[(3-ethyl-1-methylpyrazole-5-carbonyl)amino]oxyacetic acid |
| SMILES | CCc1cc(C(=O)NOCC(=O)O)n(C)n1 |
| InChI | InChI=1S/C9H13N3O4/c1-3-6-4-7(12(2)10-6)9(15)11-16-5-8(13)14/h4H,3,5H2,1-2H3,(H,11,15)(H,13,14) |
| InChIKey | SMMZMYNMYUHAEY-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|