C11H19N3O3 — CID 82721370
1,3-diethyl-N-(2-methoxyethoxy)pyrazole-5-carboxamide (PubChem CID 82721370) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1,3-diethyl-N-(2-methoxyethoxy)pyrazole-5-carboxamide.
| Compound Name | 1,3-diethyl-N-(2-methoxyethoxy)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 82721370 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1,3-diethyl-N-(2-methoxyethoxy)pyrazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)NOCCOC)n(CC)n1 |
| InChI | InChI=1S/C11H19N3O3/c1-4-9-8-10(14(5-2)12-9)11(15)13-17-7-6-16-3/h8H,4-7H2,1-3H3,(H,13,15) |
| InChIKey | VNZDOILNZQFIDO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|