C9H15N3O3 — CID 79676798
N-(2-methoxyethoxy)-2,5-dimethylpyrazole-3-carboxamide (PubChem CID 79676798) has the molecular formula C9H15N3O3 and a molecular weight of 213.24 g/mol. Its IUPAC name is N-(2-methoxyethoxy)-2,5-dimethylpyrazole-3-carboxamide.
| Compound Name | N-(2-methoxyethoxy)-2,5-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 79676798 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | N-(2-methoxyethoxy)-2,5-dimethylpyrazole-3-carboxamide |
| SMILES | COCCONC(=O)c1cc(C)nn1C |
| InChI | InChI=1S/C9H15N3O3/c1-7-6-8(12(2)10-7)9(13)11-15-5-4-14-3/h6H,4-5H2,1-3H3,(H,11,13) |
| InChIKey | ZXUVXLJNSNSULO-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|