C10H17N3O2 — CID 82723366
2,5-dimethyl-N-[(2-methylpropan-2-yl)oxy]pyrazole-3-carboxamide (PubChem CID 82723366) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2,5-dimethyl-N-[(2-methylpropan-2-yl)oxy]pyrazole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[(2-methylpropan-2-yl)oxy]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 82723366 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2,5-dimethyl-N-[(2-methylpropan-2-yl)oxy]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NOC(C)(C)C)n(C)n1 |
| InChI | InChI=1S/C10H17N3O2/c1-7-6-8(13(5)11-7)9(14)12-15-10(2,3)4/h6H,1-5H3,(H,12,14) |
| InChIKey | CWRQTJAWRYLWOF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|