C6H10ClN3O — CID 68886245
2,5-dimethylpyrazole-3-carboxamide;hydrochloride (PubChem CID 68886245) has the molecular formula C6H10ClN3O and a molecular weight of 175.62 g/mol. Its IUPAC name is 2,5-dimethylpyrazole-3-carboxamide;hydrochloride.
| Compound Name | 2,5-dimethylpyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 68886245 |
| Molecular Formula | C6H10ClN3O |
| Molecular Weight | 175.62 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 2,5-dimethylpyrazole-3-carboxamide;hydrochloride |
| SMILES | Cc1cc(C(N)=O)n(C)n1.Cl |
| InChI | InChI=1S/C6H9N3O.ClH/c1-4-3-5(6(7)10)9(2)8-4;/h3H,1-2H3,(H2,7,10);1H |
| InChIKey | CUZFLDJKLWZWMT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.62 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |