C6H7ClN2O — CID 2736299
2,5-dimethylpyrazole-3-carbonyl chloride (PubChem CID 2736299) has the molecular formula C6H7ClN2O and a molecular weight of 158.59 g/mol. Its IUPAC name is 2,5-dimethylpyrazole-3-carbonyl chloride.
| Compound Name | 2,5-dimethylpyrazole-3-carbonyl chloride |
|---|---|
| PubChem CID | 2736299 |
| Molecular Formula | C6H7ClN2O |
| Molecular Weight | 158.59 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | 2,5-dimethylpyrazole-3-carbonyl chloride |
| SMILES | Cc1cc(C(=O)Cl)n(C)n1 |
| InChI | InChI=1S/C6H7ClN2O/c1-4-3-5(6(7)10)9(2)8-4/h3H,1-2H3 |
| InChIKey | ZIAPGUFDEJWQHC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.59 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|