2-tert-butyl-5-methylpyrazole-3-carbonyl chloride

C9H13ClN2O — CID 2799340

IUPAC2-tert-butyl-5-methylpyrazole-3-carbonyl chloride
SMILESCc1cc(C(=O)Cl)n(C(C)(C)C)n1
InChIInChI=1S/C9H13ClN2O/c1-6-5-7(8(10)13)12(11-6)9(2,3)4/h5H,1-4H3
InChIKeyQHWPUBKIGZTZRC-UHFFFAOYSA-N
MW200.67 g/mol
LogP2.33
Rot. Bonds1

About 2-tert-butyl-5-methylpyrazole-3-carbonyl chloride

2-tert-butyl-5-methylpyrazole-3-carbonyl chloride (PubChem CID 2799340) has the molecular formula C9H13ClN2O and a molecular weight of 200.67 g/mol. Its IUPAC name is 2-tert-butyl-5-methylpyrazole-3-carbonyl chloride.

Molecular Properties

Compound Name2-tert-butyl-5-methylpyrazole-3-carbonyl chloride
PubChem CID2799340
Molecular FormulaC9H13ClN2O
Molecular Weight200.67 g/mol
Exact Mass200.07
IUPAC Name2-tert-butyl-5-methylpyrazole-3-carbonyl chloride
SMILESCc1cc(C(=O)Cl)n(C(C)(C)C)n1
InChIInChI=1S/C9H13ClN2O/c1-6-5-7(8(10)13)12(11-6)9(2,3)4/h5H,1-4H3
InChIKeyQHWPUBKIGZTZRC-UHFFFAOYSA-N
XLogP2.33
TPSA34.89 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.67
LogP ≤ 52.33
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-tert-butyl-5-methylpyrazole-3-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-tert-butyl-5-methylpyrazole-3-carbonyl chloride?
The IUPAC name of 2-tert-butyl-5-methylpyrazole-3-carbonyl chloride (CID 2799340) is 2-tert-butyl-5-methylpyrazole-3-carbonyl chloride.
What is the SMILES notation for 2-tert-butyl-5-methylpyrazole-3-carbonyl chloride?
The canonical SMILES for 2-tert-butyl-5-methylpyrazole-3-carbonyl chloride is Cc1cc(C(=O)Cl)n(C(C)(C)C)n1.
What is the InChIKey of 2-tert-butyl-5-methylpyrazole-3-carbonyl chloride?
The InChIKey is QHWPUBKIGZTZRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN2O/c1-6-5-7(8(10)13)12(11-6)9(2,3)4/h5H,1-4H3.
What are the key properties of 2-tert-butyl-5-methylpyrazole-3-carbonyl chloride?
2-tert-butyl-5-methylpyrazole-3-carbonyl chloride has a molecular weight of 200.67 g/mol, XLogP of 2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-methylpyrazole-3-carbonyl chloride is sourced from PubChem (CID 2799340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).