C10H14N2O3 — CID 6422536
ethyl 3-(2,5-dimethylpyrazol-3-yl)-3-oxopropanoate (PubChem CID 6422536) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is ethyl 3-(2,5-dimethylpyrazol-3-yl)-3-oxopropanoate.
| Compound Name | ethyl 3-(2,5-dimethylpyrazol-3-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 6422536 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | ethyl 3-(2,5-dimethylpyrazol-3-yl)-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1cc(C)nn1C |
| InChI | InChI=1S/C10H14N2O3/c1-4-15-10(14)6-9(13)8-5-7(2)11-12(8)3/h5H,4,6H2,1-3H3 |
| InChIKey | CZWRZJMYVBZWSZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|