C12H18N2O3S — CID 103485728
ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate (PubChem CID 103485728) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate.
| Compound Name | ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate |
|---|---|
| PubChem CID | 103485728 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate |
| SMILES | CCOC(=O)CCC(=O)CSc1cc(C)nn1C |
| InChI | InChI=1S/C12H18N2O3S/c1-4-17-12(16)6-5-10(15)8-18-11-7-9(2)13-14(11)3/h7H,4-6,8H2,1-3H3 |
| InChIKey | NKKVATKAUGOKQW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |