ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate

C12H18N2O3S — CID 103485728

IUPACethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate
SMILESCCOC(=O)CCC(=O)CSc1cc(C)nn1C
InChIInChI=1S/C12H18N2O3S/c1-4-17-12(16)6-5-10(15)8-18-11-7-9(2)13-14(11)3/h7H,4-6,8H2,1-3H3
InChIKeyNKKVATKAUGOKQW-UHFFFAOYSA-N
MW270.35 g/mol
LogP1.73
Rot. Bonds7

About ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate

ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate (PubChem CID 103485728) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate.

Molecular Properties

Compound Nameethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate
PubChem CID103485728
Molecular FormulaC12H18N2O3S
Molecular Weight270.35 g/mol
Exact Mass270.10
IUPAC Nameethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate
SMILESCCOC(=O)CCC(=O)CSc1cc(C)nn1C
InChIInChI=1S/C12H18N2O3S/c1-4-17-12(16)6-5-10(15)8-18-11-7-9(2)13-14(11)3/h7H,4-6,8H2,1-3H3
InChIKeyNKKVATKAUGOKQW-UHFFFAOYSA-N
XLogP1.73
TPSA61.19 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds7
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.35
LogP ≤ 51.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate?
The IUPAC name of ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate (CID 103485728) is ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate.
What is the SMILES notation for ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate?
The canonical SMILES for ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate is CCOC(=O)CCC(=O)CSc1cc(C)nn1C.
What is the InChIKey of ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate?
The InChIKey is NKKVATKAUGOKQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3S/c1-4-17-12(16)6-5-10(15)8-18-11-7-9(2)13-14(11)3/h7H,4-6,8H2,1-3H3.
What are the key properties of ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate?
ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate has a molecular weight of 270.35 g/mol, XLogP of 1.73, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(2,5-dimethylpyrazol-3-yl)sulfanyl-4-oxopentanoate is sourced from PubChem (CID 103485728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).