C9H12N2O3S2 — CID 103485711
ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate (PubChem CID 103485711) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate.
| Compound Name | ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 103485711 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate |
| SMILES | CCOC(=O)CCC(=O)CSc1nncs1 |
| InChI | InChI=1S/C9H12N2O3S2/c1-2-14-8(13)4-3-7(12)5-15-9-11-10-6-16-9/h6H,2-5H2,1H3 |
| InChIKey | NTDVWDVTUJWCSA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |