ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate

C9H12N2O3S2 — CID 103485711

IUPACethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate
SMILESCCOC(=O)CCC(=O)CSc1nncs1
InChIInChI=1S/C9H12N2O3S2/c1-2-14-8(13)4-3-7(12)5-15-9-11-10-6-16-9/h6H,2-5H2,1H3
InChIKeyNTDVWDVTUJWCSA-UHFFFAOYSA-N
MW260.34 g/mol
LogP1.54
Rot. Bonds7

About ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate

ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate (PubChem CID 103485711) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate.

Molecular Properties

Compound Nameethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate
PubChem CID103485711
Molecular FormulaC9H12N2O3S2
Molecular Weight260.34 g/mol
Exact Mass260.03
IUPAC Nameethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate
SMILESCCOC(=O)CCC(=O)CSc1nncs1
InChIInChI=1S/C9H12N2O3S2/c1-2-14-8(13)4-3-7(12)5-15-9-11-10-6-16-9/h6H,2-5H2,1H3
InChIKeyNTDVWDVTUJWCSA-UHFFFAOYSA-N
XLogP1.54
TPSA69.15 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.34
LogP ≤ 51.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate?
The IUPAC name of ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate (CID 103485711) is ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate.
What is the SMILES notation for ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate?
The canonical SMILES for ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate is CCOC(=O)CCC(=O)CSc1nncs1.
What is the InChIKey of ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate?
The InChIKey is NTDVWDVTUJWCSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3S2/c1-2-14-8(13)4-3-7(12)5-15-9-11-10-6-16-9/h6H,2-5H2,1H3.
What are the key properties of ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate?
ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate has a molecular weight of 260.34 g/mol, XLogP of 1.54, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-oxo-5-(1,3,4-thiadiazol-2-ylsulfanyl)pentanoate is sourced from PubChem (CID 103485711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).