C10H18N4O — CID 66121952
N-(2-aminoethyl)-1,3-diethylpyrazole-5-carboxamide (PubChem CID 66121952) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is N-(2-aminoethyl)-1,3-diethylpyrazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-1,3-diethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 66121952 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N-(2-aminoethyl)-1,3-diethylpyrazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)NCCN)n(CC)n1 |
| InChI | InChI=1S/C10H18N4O/c1-3-8-7-9(14(4-2)13-8)10(15)12-6-5-11/h7H,3-6,11H2,1-2H3,(H,12,15) |
| InChIKey | NWRQJEFVXZJKNZ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |