C14H26N4O — CID 66120244
N-(2-aminoethyl)-N-butyl-1,3-diethylpyrazole-5-carboxamide (PubChem CID 66120244) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-butyl-1,3-diethylpyrazole-5-carboxamide.
| Compound Name | N-(2-aminoethyl)-N-butyl-1,3-diethylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 66120244 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | N-(2-aminoethyl)-N-butyl-1,3-diethylpyrazole-5-carboxamide |
| SMILES | CCCCN(CCN)C(=O)c1cc(CC)nn1CC |
| InChI | InChI=1S/C14H26N4O/c1-4-7-9-17(10-8-15)14(19)13-11-12(5-2)16-18(13)6-3/h11H,4-10,15H2,1-3H3 |
| InChIKey | RGDNKOCTYDQAIH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |