C14H24BrN3O — CID 80661593
N-(3-bromopropyl)-1,3-diethyl-N-propan-2-ylpyrazole-5-carboxamide (PubChem CID 80661593) has the molecular formula C14H24BrN3O and a molecular weight of 330.27 g/mol. Its IUPAC name is N-(3-bromopropyl)-1,3-diethyl-N-propan-2-ylpyrazole-5-carboxamide.
| Compound Name | N-(3-bromopropyl)-1,3-diethyl-N-propan-2-ylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 80661593 |
| Molecular Formula | C14H24BrN3O |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-(3-bromopropyl)-1,3-diethyl-N-propan-2-ylpyrazole-5-carboxamide |
| SMILES | CCc1cc(C(=O)N(CCCBr)C(C)C)n(CC)n1 |
| InChI | InChI=1S/C14H24BrN3O/c1-5-12-10-13(18(6-2)16-12)14(19)17(11(3)4)9-7-8-15/h10-11H,5-9H2,1-4H3 |
| InChIKey | DICFIMXYQXIXRR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|