C12H19N3O3 — CID 66121770
2-[(1,3-diethylpyrazole-5-carbonyl)-ethylamino]acetic acid (PubChem CID 66121770) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-[(1,3-diethylpyrazole-5-carbonyl)-ethylamino]acetic acid.
| Compound Name | 2-[(1,3-diethylpyrazole-5-carbonyl)-ethylamino]acetic acid |
|---|---|
| PubChem CID | 66121770 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 2-[(1,3-diethylpyrazole-5-carbonyl)-ethylamino]acetic acid |
| SMILES | CCc1cc(C(=O)N(CC)CC(=O)O)n(CC)n1 |
| InChI | InChI=1S/C12H19N3O3/c1-4-9-7-10(15(6-3)13-9)12(18)14(5-2)8-11(16)17/h7H,4-6,8H2,1-3H3,(H,16,17) |
| InChIKey | FHNQKEUBEAWKHZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |