C13H21N3O3 — CID 66121962
2-[(1,3-diethylpyrazole-5-carbonyl)-propylamino]acetic acid (PubChem CID 66121962) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-[(1,3-diethylpyrazole-5-carbonyl)-propylamino]acetic acid.
| Compound Name | 2-[(1,3-diethylpyrazole-5-carbonyl)-propylamino]acetic acid |
|---|---|
| PubChem CID | 66121962 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2-[(1,3-diethylpyrazole-5-carbonyl)-propylamino]acetic acid |
| SMILES | CCCN(CC(=O)O)C(=O)c1cc(CC)nn1CC |
| InChI | InChI=1S/C13H21N3O3/c1-4-7-15(9-12(17)18)13(19)11-8-10(5-2)14-16(11)6-3/h8H,4-7,9H2,1-3H3,(H,17,18) |
| InChIKey | SFFBNTGLTHXMDF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |