C7H6BrF2NO2 — CID 131041505
5-bromo-N-(2,2-difluoroethyl)furan-3-carboxamide (PubChem CID 131041505) has the molecular formula C7H6BrF2NO2 and a molecular weight of 254.03 g/mol. Its IUPAC name is 5-bromo-N-(2,2-difluoroethyl)furan-3-carboxamide.
| Compound Name | 5-bromo-N-(2,2-difluoroethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 131041505 |
| Molecular Formula | C7H6BrF2NO2 |
| Molecular Weight | 254.03 g/mol |
| Exact Mass | 252.95 |
| IUPAC Name | 5-bromo-N-(2,2-difluoroethyl)furan-3-carboxamide |
| SMILES | O=C(NCC(F)F)c1coc(Br)c1 |
| InChI | InChI=1S/C7H6BrF2NO2/c8-5-1-4(3-13-5)7(12)11-2-6(9)10/h1,3,6H,2H2,(H,11,12) |
| InChIKey | VRGAYGDRAVKPIZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.03 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |