C10H13BrN2O3 — CID 120943152
5-bromo-N-[(4-hydroxypyrrolidin-3-yl)methyl]furan-3-carboxamide (PubChem CID 120943152) has the molecular formula C10H13BrN2O3 and a molecular weight of 289.13 g/mol. Its IUPAC name is 5-bromo-N-[(4-hydroxypyrrolidin-3-yl)methyl]furan-3-carboxamide.
| Compound Name | 5-bromo-N-[(4-hydroxypyrrolidin-3-yl)methyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 120943152 |
| Molecular Formula | C10H13BrN2O3 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 5-bromo-N-[(4-hydroxypyrrolidin-3-yl)methyl]furan-3-carboxamide |
| SMILES | O=C(NCC1CNCC1O)c1coc(Br)c1 |
| InChI | InChI=1S/C10H13BrN2O3/c11-9-1-6(5-16-9)10(15)13-3-7-2-12-4-8(7)14/h1,5,7-8,12,14H,2-4H2,(H,13,15) |
| InChIKey | AERIMXOBHPXJKU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |