C14H20N2O4 — CID 120946857
N-[(4-hydroxypyrrolidin-3-yl)methyl]-3,5-dimethoxybenzamide (PubChem CID 120946857) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is N-[(4-hydroxypyrrolidin-3-yl)methyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 120946857 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCC2CNCC2O)c1 |
| InChI | InChI=1S/C14H20N2O4/c1-19-11-3-9(4-12(5-11)20-2)14(18)16-7-10-6-15-8-13(10)17/h3-5,10,13,15,17H,6-8H2,1-2H3,(H,16,18) |
| InChIKey | ALKQQFKYJGAENE-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |