C15H23ClN2O4 — CID 120946250
N-[(4-hydroxypyrrolidin-3-yl)methyl]-3-(2-methoxyethoxy)benzamide;hydrochloride (PubChem CID 120946250) has the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. Its IUPAC name is N-[(4-hydroxypyrrolidin-3-yl)methyl]-3-(2-methoxyethoxy)benzamide;hydrochloride.
| Compound Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-3-(2-methoxyethoxy)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120946250 |
| Molecular Formula | C15H23ClN2O4 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-3-(2-methoxyethoxy)benzamide;hydrochloride |
| SMILES | COCCOc1cccc(C(=O)NCC2CNCC2O)c1.Cl |
| InChI | InChI=1S/C15H22N2O4.ClH/c1-20-5-6-21-13-4-2-3-11(7-13)15(19)17-9-12-8-16-10-14(12)18;/h2-4,7,12,14,16,18H,5-6,8-10H2,1H3,(H,17,19);1H |
| InChIKey | QQTDCHLJPVIXFG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|