C16H23FN2O4 — CID 120947477
4-fluoro-N-[(4-hydroxypyrrolidin-3-yl)methyl]-3-(2-methoxyethoxymethyl)benzamide (PubChem CID 120947477) has the molecular formula C16H23FN2O4 and a molecular weight of 326.37 g/mol. Its IUPAC name is 4-fluoro-N-[(4-hydroxypyrrolidin-3-yl)methyl]-3-(2-methoxyethoxymethyl)benzamide.
| Compound Name | 4-fluoro-N-[(4-hydroxypyrrolidin-3-yl)methyl]-3-(2-methoxyethoxymethyl)benzamide |
|---|---|
| PubChem CID | 120947477 |
| Molecular Formula | C16H23FN2O4 |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 4-fluoro-N-[(4-hydroxypyrrolidin-3-yl)methyl]-3-(2-methoxyethoxymethyl)benzamide |
| SMILES | COCCOCc1cc(C(=O)NCC2CNCC2O)ccc1F |
| InChI | InChI=1S/C16H23FN2O4/c1-22-4-5-23-10-12-6-11(2-3-14(12)17)16(21)19-8-13-7-18-9-15(13)20/h2-3,6,13,15,18,20H,4-5,7-10H2,1H3,(H,19,21) |
| InChIKey | QMPQGKRECGTZAI-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|