C18H26ClFN2O3 — CID 119456779
N-(8-azabicyclo[3.2.1]octan-3-yl)-4-fluoro-3-(2-methoxyethoxymethyl)benzamide;hydrochloride (PubChem CID 119456779) has the molecular formula C18H26ClFN2O3 and a molecular weight of 372.87 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-4-fluoro-3-(2-methoxyethoxymethyl)benzamide;hydrochloride.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-4-fluoro-3-(2-methoxyethoxymethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119456779 |
| Molecular Formula | C18H26ClFN2O3 |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-4-fluoro-3-(2-methoxyethoxymethyl)benzamide;hydrochloride |
| SMILES | COCCOCc1cc(C(=O)NC2CC3CCC(C2)N3)ccc1F.Cl |
| InChI | InChI=1S/C18H25FN2O3.ClH/c1-23-6-7-24-11-13-8-12(2-5-17(13)19)18(22)21-16-9-14-3-4-15(10-16)20-14;/h2,5,8,14-16,20H,3-4,6-7,9-11H2,1H3,(H,21,22);1H |
| InChIKey | MHWWPVFDFMYEEH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|