C18H26ClFN2O3 — CID 119636598
3,9-diazabicyclo[4.2.1]nonan-3-yl-[4-fluoro-3-(2-methoxyethoxymethyl)phenyl]methanone;hydrochloride (PubChem CID 119636598) has the molecular formula C18H26ClFN2O3 and a molecular weight of 372.87 g/mol. Its IUPAC name is 3,9-diazabicyclo[4.2.1]nonan-3-yl-[4-fluoro-3-(2-methoxyethoxymethyl)phenyl]methanone;hydrochloride.
| Compound Name | 3,9-diazabicyclo[4.2.1]nonan-3-yl-[4-fluoro-3-(2-methoxyethoxymethyl)phenyl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119636598 |
| Molecular Formula | C18H26ClFN2O3 |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 3,9-diazabicyclo[4.2.1]nonan-3-yl-[4-fluoro-3-(2-methoxyethoxymethyl)phenyl]methanone;hydrochloride |
| SMILES | COCCOCc1cc(C(=O)N2CCC3CCC(C2)N3)ccc1F.Cl |
| InChI | InChI=1S/C18H25FN2O3.ClH/c1-23-8-9-24-12-14-10-13(2-5-17(14)19)18(22)21-7-6-15-3-4-16(11-21)20-15;/h2,5,10,15-16,20H,3-4,6-9,11-12H2,1H3;1H |
| InChIKey | SGAJCPVMTZTNLQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|