C15H21FN2O3 — CID 119410772
[(3R)-3-aminopyrrolidin-1-yl]-[4-fluoro-3-(2-methoxyethoxymethyl)phenyl]methanone (PubChem CID 119410772) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is [(3R)-3-aminopyrrolidin-1-yl]-[4-fluoro-3-(2-methoxyethoxymethyl)phenyl]methanone.
| Compound Name | [(3R)-3-aminopyrrolidin-1-yl]-[4-fluoro-3-(2-methoxyethoxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 119410772 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | [(3R)-3-aminopyrrolidin-1-yl]-[4-fluoro-3-(2-methoxyethoxymethyl)phenyl]methanone |
| SMILES | COCCOCc1cc(C(=O)N2CC[C@@H](N)C2)ccc1F |
| InChI | InChI=1S/C15H21FN2O3/c1-20-6-7-21-10-12-8-11(2-3-14(12)16)15(19)18-5-4-13(17)9-18/h2-3,8,13H,4-7,9-10,17H2,1H3/t13-/m1/s1 |
| InChIKey | QYSBFQBHWWFZDG-CYBMUJFWSA-N |
| XLogP | 1.16 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|