C20H29N3O3 — CID 160583776
4-N-(8-azabicyclo[3.2.1]octan-3-yl)-2-(4-methoxybutyl)benzene-1,4-dicarboxamide (PubChem CID 160583776) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-N-(8-azabicyclo[3.2.1]octan-3-yl)-2-(4-methoxybutyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(8-azabicyclo[3.2.1]octan-3-yl)-2-(4-methoxybutyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 160583776 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 4-N-(8-azabicyclo[3.2.1]octan-3-yl)-2-(4-methoxybutyl)benzene-1,4-dicarboxamide |
| SMILES | COCCCCc1cc(C(=O)NC2CC3CCC(C2)N3)ccc1C(N)=O |
| InChI | InChI=1S/C20H29N3O3/c1-26-9-3-2-4-13-10-14(5-8-18(13)19(21)24)20(25)23-17-11-15-6-7-16(12-17)22-15/h5,8,10,15-17,22H,2-4,6-7,9,11-12H2,1H3,(H2,21,24)(H,23,25) |
| InChIKey | GANYEYHBNLKYLK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|