C19H24ClN3O3 — CID 120945808
N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-(4-methoxyanilino)benzamide;hydrochloride (PubChem CID 120945808) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-(4-methoxyanilino)benzamide;hydrochloride.
| Compound Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-(4-methoxyanilino)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120945808 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[(4-hydroxypyrrolidin-3-yl)methyl]-2-(4-methoxyanilino)benzamide;hydrochloride |
| SMILES | COc1ccc(Nc2ccccc2C(=O)NCC2CNCC2O)cc1.Cl |
| InChI | InChI=1S/C19H23N3O3.ClH/c1-25-15-8-6-14(7-9-15)22-17-5-3-2-4-16(17)19(24)21-11-13-10-20-12-18(13)23;/h2-9,13,18,20,22-23H,10-12H2,1H3,(H,21,24);1H |
| InChIKey | XPVLVGFIINFNBL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |