C12H13F3N2O2 — CID 120944182
2,4,6-trifluoro-N-[(4-hydroxypyrrolidin-3-yl)methyl]benzamide (PubChem CID 120944182) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2,4,6-trifluoro-N-[(4-hydroxypyrrolidin-3-yl)methyl]benzamide.
| Compound Name | 2,4,6-trifluoro-N-[(4-hydroxypyrrolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 120944182 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 2,4,6-trifluoro-N-[(4-hydroxypyrrolidin-3-yl)methyl]benzamide |
| SMILES | O=C(NCC1CNCC1O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C12H13F3N2O2/c13-7-1-8(14)11(9(15)2-7)12(19)17-4-6-3-16-5-10(6)18/h1-2,6,10,16,18H,3-5H2,(H,17,19) |
| InChIKey | XVOLQWYFVIHWAZ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |