C12H14FNO3S — CID 120526481
2-[2-[(4-fluoro-2-methylbenzoyl)amino]ethylsulfanyl]acetic acid (PubChem CID 120526481) has the molecular formula C12H14FNO3S and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-[2-[(4-fluoro-2-methylbenzoyl)amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[(4-fluoro-2-methylbenzoyl)amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 120526481 |
| Molecular Formula | C12H14FNO3S |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-[2-[(4-fluoro-2-methylbenzoyl)amino]ethylsulfanyl]acetic acid |
| SMILES | Cc1cc(F)ccc1C(=O)NCCSCC(=O)O |
| InChI | InChI=1S/C12H14FNO3S/c1-8-6-9(13)2-3-10(8)12(17)14-4-5-18-7-11(15)16/h2-3,6H,4-5,7H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | WJWUTAYYNDDGNL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|