C14H20FNOS — CID 104920099
4-fluoro-2-methyl-N-(5-methylsulfanylpentyl)benzamide (PubChem CID 104920099) has the molecular formula C14H20FNOS and a molecular weight of 269.38 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N-(5-methylsulfanylpentyl)benzamide.
| Compound Name | 4-fluoro-2-methyl-N-(5-methylsulfanylpentyl)benzamide |
|---|---|
| PubChem CID | 104920099 |
| Molecular Formula | C14H20FNOS |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 4-fluoro-2-methyl-N-(5-methylsulfanylpentyl)benzamide |
| SMILES | CSCCCCCNC(=O)c1ccc(F)cc1C |
| InChI | InChI=1S/C14H20FNOS/c1-11-10-12(15)6-7-13(11)14(17)16-8-4-3-5-9-18-2/h6-7,10H,3-5,8-9H2,1-2H3,(H,16,17) |
| InChIKey | BCWRGLKCUJUHSY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|