3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid

C10H10Cl2N2O3 — CID 103602717

IUPAC3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid
SMILESCC(CC(=O)O)NC(=O)c1cc(Cl)nc(Cl)c1
InChIInChI=1S/C10H10Cl2N2O3/c1-5(2-9(15)16)13-10(17)6-3-7(11)14-8(12)4-6/h3-5H,2H2,1H3,(H,13,17)(H,15,16)
InChIKeyVQGXTSVEBLSKSG-UHFFFAOYSA-N
MW277.11 g/mol
LogP1.98
Rot. Bonds4

About 3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid

3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid (PubChem CID 103602717) has the molecular formula C10H10Cl2N2O3 and a molecular weight of 277.11 g/mol. Its IUPAC name is 3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid.

Molecular Properties

Compound Name3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid
PubChem CID103602717
Molecular FormulaC10H10Cl2N2O3
Molecular Weight277.11 g/mol
Exact Mass276.01
IUPAC Name3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid
SMILESCC(CC(=O)O)NC(=O)c1cc(Cl)nc(Cl)c1
InChIInChI=1S/C10H10Cl2N2O3/c1-5(2-9(15)16)13-10(17)6-3-7(11)14-8(12)4-6/h3-5H,2H2,1H3,(H,13,17)(H,15,16)
InChIKeyVQGXTSVEBLSKSG-UHFFFAOYSA-N
XLogP1.98
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.11
LogP ≤ 51.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze 3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid?
The IUPAC name of 3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid (CID 103602717) is 3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid.
What is the SMILES notation for 3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid?
The canonical SMILES for 3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid is CC(CC(=O)O)NC(=O)c1cc(Cl)nc(Cl)c1.
What is the InChIKey of 3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid?
The InChIKey is VQGXTSVEBLSKSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Cl2N2O3/c1-5(2-9(15)16)13-10(17)6-3-7(11)14-8(12)4-6/h3-5H,2H2,1H3,(H,13,17)(H,15,16).
What are the key properties of 3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid?
3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid has a molecular weight of 277.11 g/mol, XLogP of 1.98, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dichloropyridine-4-carbonyl)amino]butanoic acid is sourced from PubChem (CID 103602717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).