C12H19ClN4O — CID 62185813
2-amino-6-chloro-N-[4-(dimethylamino)butan-2-yl]pyridine-4-carboxamide (PubChem CID 62185813) has the molecular formula C12H19ClN4O and a molecular weight of 270.76 g/mol. Its IUPAC name is 2-amino-6-chloro-N-[4-(dimethylamino)butan-2-yl]pyridine-4-carboxamide.
| Compound Name | 2-amino-6-chloro-N-[4-(dimethylamino)butan-2-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 62185813 |
| Molecular Formula | C12H19ClN4O |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-amino-6-chloro-N-[4-(dimethylamino)butan-2-yl]pyridine-4-carboxamide |
| SMILES | CC(CCN(C)C)NC(=O)c1cc(N)nc(Cl)c1 |
| InChI | InChI=1S/C12H19ClN4O/c1-8(4-5-17(2)3)15-12(18)9-6-10(13)16-11(14)7-9/h6-8H,4-5H2,1-3H3,(H2,14,16)(H,15,18) |
| InChIKey | VIWWERJOIWUTSY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|